|
CAS#: 13185-55-2 Product: Thiochrome Diphosphate No suppilers available for the product. |
| Name | Thiochrome Diphosphate |
|---|---|
| Synonyms | Thiochrome Diphosphate |
| Molecular Structure | ![]() |
| Molecular Formula | C12H16N4O7P2S |
| Molecular Weight | 422.29 |
| CAS Registry Number | 13185-55-2 |
| SMILES | C1=C3C(=NC(=N1)C)N=C2SC(=C(N2C3)C)CCO[P](O[P](=O)(O)O)(=O)O |
| InChI | 1S/C12H16N4O7P2S/c1-7-10(3-4-22-25(20,21)23-24(17,18)19)26-12-15-11-9(6-16(7)12)5-13-8(2)14-11/h5H,3-4,6H2,1-2H3,(H,20,21)(H2,17,18,19) |
| InChIKey | DEEKUGGTHPYDAX-UHFFFAOYSA-N |
| Density | 1.935g/cm3 (Cal.) |
|---|---|
| Boiling point | 687.992°C at 760 mmHg (Cal.) |
| Flash point | 369.884°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Thiochrome Diphosphate |