|
CAS#: 131887-44-0 Product: (3R)-6-Acetamido-3-Aminohexanoic Acid No suppilers available for the product. |
| Name | (3R)-6-Acetamido-3-Aminohexanoic Acid |
|---|---|
| Synonyms | (3R)-6-Acetamido-3-Amino-Hexanoic Acid; N'-Acetyl-Beta-Lysine |
| Molecular Structure | ![]() |
| Molecular Formula | C8H16N2O3 |
| Molecular Weight | 188.23 |
| CAS Registry Number | 131887-44-0 |
| SMILES | [C@H](N)(CC(=O)O)CCCNC(=O)C |
| InChI | 1S/C8H16N2O3/c1-6(11)10-4-2-3-7(9)5-8(12)13/h7H,2-5,9H2,1H3,(H,10,11)(H,12,13)/t7-/m1/s1 |
| InChIKey | MBZWIPOSTWTKSV-SSDOTTSWSA-N |
| Density | 1.139g/cm3 (Cal.) |
|---|---|
| Boiling point | 449.005°C at 760 mmHg (Cal.) |
| Flash point | 225.351°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (3R)-6-Acetamido-3-Aminohexanoic Acid |