|
CAS#: 132-89-8 Product: 2-(2-Chloroethyl)-2,3-Dihydro-1,3-Benzoxazin-4-One No suppilers available for the product. |
| Name | 2-(2-Chloroethyl)-2,3-Dihydro-1,3-Benzoxazin-4-One |
|---|---|
| Synonyms | Valtorin; 2-(.Beta.-Chloroethyl)-2,3-Dihydro-4-Oxo(Benzo-1,3-Oxazine); 4-Oxo-2-(.Beta.-Chloroethyl)-2,3-Dihydrobenzo-1,3-Oxazine |
| Molecular Structure | ![]() |
| Molecular Formula | C10H10ClNO2 |
| Molecular Weight | 211.65 |
| CAS Registry Number | 132-89-8 |
| EINECS | 205-082-3 |
| SMILES | C1=C2C(=CC=C1)OC(CCCl)NC2=O |
| InChI | 1S/C10H10ClNO2/c11-6-5-9-12-10(13)7-3-1-2-4-8(7)14-9/h1-4,9H,5-6H2,(H,12,13) |
| InChIKey | YEKMWXFHPZBZLR-UHFFFAOYSA-N |
| Density | 1.254g/cm3 (Cal.) |
|---|---|
| Boiling point | 449.771°C at 760 mmHg (Cal.) |
| Flash point | 225.813°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2-(2-Chloroethyl)-2,3-Dihydro-1,3-Benzoxazin-4-One |