|
CAS#: 13221-27-7 Product: Tribuzone No suppilers available for the product. |
| Name | Tribuzone |
|---|---|
| Synonyms | 4-(4,4-Dimethyl-3-Oxo-Pentyl)-1,2-Di(Phenyl)Pyrazolidine-3,5-Dione; 4-(3-Keto-4,4-Dimethyl-Pentyl)-1,2-Di(Phenyl)Pyrazolidine-3,5-Quinone; 3,5-Pyrazolidinedione, 4-(4,4-Dimethyl-3-Oxopentyl)-1,2-Diphenyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C22H24N2O3 |
| Molecular Weight | 364.44 |
| CAS Registry Number | 13221-27-7 |
| EINECS | 236-191-4 |
| SMILES | C1=CC=CC=C1N3N(C2=CC=CC=C2)C(=O)C(C3=O)CCC(C(C)(C)C)=O |
| InChI | 1S/C22H24N2O3/c1-22(2,3)19(25)15-14-18-20(26)23(16-10-6-4-7-11-16)24(21(18)27)17-12-8-5-9-13-17/h4-13,18H,14-15H2,1-3H3 |
| InChIKey | OFVFGKQCUDMLLP-UHFFFAOYSA-N |
| Density | 1.178g/cm3 (Cal.) |
|---|---|
| Boiling point | 486.94°C at 760 mmHg (Cal.) |
| Flash point | 198.612°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Tribuzone |