|
CAS#: 132488-75-6 Product: 2,2-Difluoro-2-Deoxy-Inositol 1,4,5-Trisphosphate No suppilers available for the product. |
| Name | 2,2-Difluoro-2-Deoxy-Inositol 1,4,5-Trisphosphate |
|---|---|
| Synonyms | (4,4-Difluoro-2,5-Dihydroxy-3,6-Diphosphonooxy-Cyclohexyl) Dihydrogen Phosphate; 2,2-Difluoro-2-Deoxy-Inositol 1,4,5-Trisphosphate; 2,2-F-Ip3 |
| Molecular Structure | ![]() |
| Molecular Formula | C6H13F2O14P3 |
| Molecular Weight | 440.08 |
| CAS Registry Number | 132488-75-6 |
| SMILES | O=[P](OC1C(F)(F)C(O)C(O[P](=O)(O)O)C(O[P](=O)(O)O)C1O)(O)O |
| InChI | 1S/C6H13F2O14P3/c7-6(8)4(10)3(21-24(14,15)16)2(20-23(11,12)13)1(9)5(6)22-25(17,18)19/h1-5,9-10H,(H2,11,12,13)(H2,14,15,16)(H2,17,18,19) |
| InChIKey | JEHSVQICCQDKLQ-UHFFFAOYSA-N |
| Density | 2.21g/cm3 (Cal.) |
|---|---|
| Boiling point | 849.008°C at 760 mmHg (Cal.) |
| Flash point | 467.263°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2-Difluoro-2-Deoxy-Inositol 1,4,5-Trisphosphate |