|
CAS#: 13345-23-8 Product: 1-Hydroxybenzo(a)Pyrene No suppilers available for the product. |
| Name | 1-Hydroxybenzo(a)Pyrene |
|---|---|
| Synonyms | 1-Benzo[I]Pyrenol; 1-Hydroxybenzo(A)Pyrene; 3-06-00-03808 (Beilstein Handbook Reference) |
| Molecular Structure | ![]() |
| Molecular Formula | C20H12O |
| Molecular Weight | 268.31 |
| CAS Registry Number | 13345-23-8 |
| SMILES | C1=CC(=C5C2=C1C=CC3=C2C(=C4C(=C3)C=CC=C4)C=C5)O |
| InChI | 1S/C20H12O/c21-18-10-7-12-5-6-14-11-13-3-1-2-4-15(13)16-8-9-17(18)19(12)20(14)16/h1-11,21H |
| InChIKey | GPIRWWPRDKGKPS-UHFFFAOYSA-N |
| Density | 1.379g/cm3 (Cal.) |
|---|---|
| Boiling point | 527.227°C at 760 mmHg (Cal.) |
| Flash point | 252.929°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Hydroxybenzo(a)Pyrene |