|
CAS#: 133645-02-0 Product: (+/-)-Anti-7-Methylbenz(a)Anthracene 3,4-Dihydrodiol 1,2-Epoxide No suppilers available for the product. |
| Name | (+/-)-Anti-7-Methylbenz(a)Anthracene 3,4-Dihydrodiol 1,2-Epoxide |
|---|---|
| Synonyms | (+/-)-Anti-7-Methylbenz(A)Anthracene-3,4-Dihydrodiol-1,2-Epoxide; 7-Methylbenz(A)Anthracene 3,4-Dihydrodiol 1,2-Epoxide; Benzo(6,7)Phenanthro(3,4-B)Oxirene-2,3-Diol, 1A-2,3,11C-Tetrahydro-6-Methyl-, (1Aalpha,2Beta,3Alpha,11Calpha)-(+-)- |
| Molecular Structure | ![]() |
| Molecular Formula | C19H16O3 |
| Molecular Weight | 292.33 |
| CAS Registry Number | 133645-02-0 |
| SMILES | [C@@H]4(C3=C(C2=CC1=CC=CC=C1C(=C2C=C3)C)[C@H]5[C@@H]([C@@H]4O)O5)O |
| InChI | 1S/C19H16O3/c1-9-11-5-3-2-4-10(11)8-14-12(9)6-7-13-15(14)18-19(22-18)17(21)16(13)20/h2-8,16-21H,1H3/t16-,17+,18-,19+/m0/s1 |
| InChIKey | CTCQBMGFYNPCAS-ZSYWTGECSA-N |
| Density | 1.429g/cm3 (Cal.) |
|---|---|
| Boiling point | 573.381°C at 760 mmHg (Cal.) |
| Flash point | 300.57°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (+/-)-Anti-7-Methylbenz(a)Anthracene 3,4-Dihydrodiol 1,2-Epoxide |