|
CAS#: 13376-38-0 Product: 2-(3-Chloro-4-Cyclohexyl-Phenyl)Propanoic Acid No suppilers available for the product. |
| Name | 2-(3-Chloro-4-Cyclohexyl-Phenyl)Propanoic Acid |
|---|---|
| Synonyms | 2-(3-Chloro-4-Cyclohexyl-Phenyl)Propanoic Acid; 2-(3-Chloro-4-Cyclohexyl-Phenyl)Propionic Acid; (3-Chloro-4-Cyclohexylphenyl)Propionic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C15H19ClO2 |
| Molecular Weight | 266.77 |
| CAS Registry Number | 13376-38-0 |
| SMILES | C1=CC(=C(Cl)C=C1C(C)C(O)=O)C2CCCCC2 |
| InChI | 1S/C15H19ClO2/c1-10(15(17)18)12-7-8-13(14(16)9-12)11-5-3-2-4-6-11/h7-11H,2-6H2,1H3,(H,17,18) |
| InChIKey | ZJHLDHTYKGIXJG-UHFFFAOYSA-N |
| Density | 1.174g/cm3 (Cal.) |
|---|---|
| Boiling point | 383.534°C at 760 mmHg (Cal.) |
| Flash point | 185.755°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(3-Chloro-4-Cyclohexyl-Phenyl)Propanoic Acid |