|
CAS#: 13396-93-5 Product: 3,12-Dihydro-6-Hydroxy-3,3-Dimethyl-7H-Pyrano(2,3-c)Acridin-7-One No suppilers available for the product. |
| Name | 3,12-Dihydro-6-Hydroxy-3,3-Dimethyl-7H-Pyrano(2,3-c)Acridin-7-One |
|---|---|
| Synonyms | Aids-007873; Aids007873; Des-N-Methyl-Noracronycine |
| Molecular Structure | ![]() |
| Molecular Formula | C18H15NO3 |
| Molecular Weight | 293.32 |
| CAS Registry Number | 13396-93-5 |
| SMILES | C3=C(C1=C(NC2=C(C1=O)C=CC=C2)C4=C3OC(C)(C)C=C4)O |
| InChI | 1S/C18H15NO3/c1-18(2)8-7-11-14(22-18)9-13(20)15-16(11)19-12-6-4-3-5-10(12)17(15)21/h3-9,20H,1-2H3,(H,19,21) |
| InChIKey | RPWNPBFZWFWZNJ-UHFFFAOYSA-N |
| Density | 1.294g/cm3 (Cal.) |
|---|---|
| Boiling point | 497.353°C at 760 mmHg (Cal.) |
| Flash point | 254.59°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,12-Dihydro-6-Hydroxy-3,3-Dimethyl-7H-Pyrano(2,3-c)Acridin-7-One |