|
CAS#: 133985-85-0 Product: 2-(1-Adamantyl)-1-(4-Iodophenyl)Guanidine No suppilers available for the product. |
| Name | 2-(1-Adamantyl)-1-(4-Iodophenyl)Guanidine |
|---|---|
| Synonyms | 1-(P-Iodophenyl)-3-(1-Adamantyl)Guanidine; I(125)-Pipag; N-(Adamant-1-Yl)-N'-(4-Iodophenyl)Guanidine |
| Molecular Structure | ![]() |
| Molecular Formula | C17H22IN3 |
| Molecular Weight | 395.29 |
| CAS Registry Number | 133985-85-0 |
| SMILES | C4=C(NC(=NC12CC3CC(C1)CC(C2)C3)N)C=CC(=C4)I |
| InChI | 1S/C17H22IN3/c18-14-1-3-15(4-2-14)20-16(19)21-17-8-11-5-12(9-17)7-13(6-11)10-17/h1-4,11-13H,5-10H2,(H3,19,20,21) |
| InChIKey | BNRDJYCVXAIEIV-UHFFFAOYSA-N |
| Density | 1.785g/cm3 (Cal.) |
|---|---|
| Boiling point | 468.148°C at 760 mmHg (Cal.) |
| Flash point | 236.928°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(1-Adamantyl)-1-(4-Iodophenyl)Guanidine |