|
CAS#: 134161-40-3 Product: N-Cyclopropylmethyl-4-Hydroxy-14-Methoxymorphinan No suppilers available for the product. |
| Name | N-Cyclopropylmethyl-4-Hydroxy-14-Methoxymorphinan |
|---|---|
| Synonyms | Cpmhmm; Morphinan-4-Ol, 17-(Cyclopropylmethyl)-14-Methoxy- |
| Molecular Structure | ![]() |
| Molecular Formula | C21H29NO2 |
| Molecular Weight | 327.47 |
| CAS Registry Number | 134161-40-3 |
| SMILES | [C@]135[C@]([C@H](N(CC1)CC2CC2)CC4=CC=CC(=C34)O)(CCCC5)OC |
| InChI | 1S/C21H29NO2/c1-24-21-10-3-2-9-20(21)11-12-22(14-15-7-8-15)18(21)13-16-5-4-6-17(23)19(16)20/h4-6,15,18,23H,2-3,7-14H2,1H3/t18-,20+,21-/m1/s1 |
| InChIKey | STAMLOCWLDFONM-HLAWJBBLSA-N |
| Density | 1.206g/cm3 (Cal.) |
|---|---|
| Boiling point | 461.814°C at 760 mmHg (Cal.) |
| Flash point | 233.097°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Cyclopropylmethyl-4-Hydroxy-14-Methoxymorphinan |