|
CAS#: 135-10-4 Product: 2-Amino-5-[(2-Carboxyphenyl)Sulfamoyl]Benzoic Acid No suppilers available for the product. |
| Name | 2-Amino-5-[(2-Carboxyphenyl)Sulfamoyl]Benzoic Acid |
|---|---|
| Synonyms | 2-Amino-5-(((2-Carboxyphenyl)Amino)Sulphonyl)Benzoic Acid; Benzoic Acid, 2-Amino-5-(((2-Carboxyphenyl)Amino)Sulfonyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C14H12N2O6S |
| Molecular Weight | 336.32 |
| CAS Registry Number | 135-10-4 |
| EINECS | 205-174-3 |
| SMILES | C1=CC=CC(=C1N[S](C2=CC(=C(N)C=C2)C(O)=O)(=O)=O)C(O)=O |
| InChI | 1S/C14H12N2O6S/c15-11-6-5-8(7-10(11)14(19)20)23(21,22)16-12-4-2-1-3-9(12)13(17)18/h1-7,16H,15H2,(H,17,18)(H,19,20) |
| InChIKey | JRNYSJXPPZZAQR-UHFFFAOYSA-N |
| Density | 1.633g/cm3 (Cal.) |
|---|---|
| Boiling point | 631.084°C at 760 mmHg (Cal.) |
| Flash point | 335.468°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Amino-5-[(2-Carboxyphenyl)Sulfamoyl]Benzoic Acid |