|
CAS#: 135446-07-0 Product: 3,9-Dimethyl-6-(Phenylmethyl)-[1,2,4]Triazolo[3,4-f]Purin-5-One No suppilers available for the product. |
| Name | 3,9-Dimethyl-6-(Phenylmethyl)-[1,2,4]Triazolo[3,4-f]Purin-5-One |
|---|---|
| Synonyms | 6-(Benzyl)-3,9-Dimethyl-[1,2,4]Triazolo[3,4-F]Purin-5-One; 3,9-Dimethyl-6-(Phenylmethyl)-6,9-Dihydro-5H-1,2,4-Triazolo(3,4-I)Purin-5-One; 5H-1,2,4-Triazolo(3,4-I)Purin-5-One, 6,9-Dihydro-3,9-Dimethyl-6-(Phenylmethyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C15H14N6O |
| Molecular Weight | 294.32 |
| CAS Registry Number | 135446-07-0 |
| SMILES | C4=NC2=C(C1=NN=C([N]1C(N2CC3=CC=CC=C3)=O)C)[N]4C |
| InChI | 1S/C15H14N6O/c1-10-17-18-14-12-13(16-9-19(12)2)20(15(22)21(10)14)8-11-6-4-3-5-7-11/h3-7,9H,8H2,1-2H3 |
| InChIKey | VTLXSLBNOQBUGC-UHFFFAOYSA-N |
| Density | 1.456g/cm3 (Cal.) |
|---|---|
| Boiling point | 670.278°C at 760 mmHg (Cal.) |
| Flash point | 359.171°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,9-Dimethyl-6-(Phenylmethyl)-[1,2,4]Triazolo[3,4-f]Purin-5-One |