|
CAS#: 13567-40-3 Product: (-)-2-Cedranone No suppilers available for the product. |
| Name | (-)-2-Cedranone |
|---|---|
| Synonyms | cedranone |
| Molecular Structure | ![]() |
| Molecular Formula | C15H24O |
| Molecular Weight | 220.35 |
| CAS Registry Number | 13567-40-3 |
| SMILES | C[C@@H]3C(=O)C[C@@H]2[C@@]13CC[C@@H](C)[C@H](C1)[C@@]2(C)C |
| InChI | 1S/C15H24O/c1-9-5-6-15-8-11(9)14(3,4)13(15)7-12(16)10(15)2/h9-11,13H,5-8H2,1-4H3/t9-,10-,11+,13+,15+/m1/s1 |
| InChIKey | XYEMOZYGHKFNMS-SGOHARFASA-N |
| Density | 1.002g/cm3 (Cal.) |
|---|---|
| Boiling point | 291.382°C at 760 mmHg (Cal.) |
| Flash point | 122.469°C (Cal.) |
| Refractive index | 1.506 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (-)-2-Cedranone |