|
CAS#: 13577-84-9 Product: N,N-Diethyl-2-Naphthamide No suppilers available for the product. |
| Name | N,N-Diethyl-2-Naphthamide |
|---|---|
| Synonyms | N,N-Diethyl-2-naphthamide # |
| Molecular Structure | ![]() |
| Molecular Formula | C15H17NO |
| Molecular Weight | 227.30 |
| CAS Registry Number | 13577-84-9 |
| SMILES | O=C(N(CC)CC)c2ccc1c(cccc1)c2 |
| InChI | 1S/C15H17NO/c1-3-16(4-2)15(17)14-10-9-12-7-5-6-8-13(12)11-14/h5-11H,3-4H2,1-2H3 |
| InChIKey | SVEQWSXJWCORQQ-UHFFFAOYSA-N |
| Density | 1.073g/cm3 (Cal.) |
|---|---|
| Boiling point | 389.312°C at 760 mmHg (Cal.) |
| Flash point | 180.318°C (Cal.) |
| Refractive index | 1.593 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N,N-Diethyl-2-Naphthamide |