|
CAS#: 13605-05-5 Product: 1,3,5-Trimethyl-2-(1-Methylethoxy)-Benzene No suppilers available for the product. |
| Name | 1,3,5-Trimethyl-2-(1-Methylethoxy)-Benzene |
|---|---|
| Synonyms | 2-Isopropoxy-1,3,5-Trimethyl-Benzene; 2-Isopropoxy-1,3,5-Trimethylbenzene; 1,3,5-Trimethyl-2-Propan-2-Yloxy-Benzene |
| Molecular Structure | ![]() |
| Molecular Formula | C12H18O |
| Molecular Weight | 178.27 |
| CAS Registry Number | 13605-05-5 |
| SMILES | C1=C(C(=C(C=C1C)C)OC(C)C)C |
| InChI | 1S/C12H18O/c1-8(2)13-12-10(4)6-9(3)7-11(12)5/h6-8H,1-5H3 |
| InChIKey | MXDPTGJZVQFULC-UHFFFAOYSA-N |
| Density | 0.911g/cm3 (Cal.) |
|---|---|
| Boiling point | 239.817°C at 760 mmHg (Cal.) |
| Flash point | 89.41°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,3,5-Trimethyl-2-(1-Methylethoxy)-Benzene |