|
CAS#: 13611-10-4 Product: 7,17-Dimethylandrostane-3,17-diol No suppilers available for the product. |
| Name | 7,17-Dimethylandrostane-3,17-diol |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C21H36O2 |
| Molecular Weight | 320.51 |
| CAS Registry Number | 13611-10-4 |
| SMILES | C[C@@H]3C[C@@H]4C[C@H](O)CCC4(C)C2CCC1(C)C(CC[C@]1(C)O)C23 |
| InChI | 1S/C21H36O2/c1-13-11-14-12-15(22)5-8-19(14,2)16-6-9-20(3)17(18(13)16)7-10-21(20,4)23/h13-18,22-23H,5-12H2,1-4H3 |
| InChIKey | ZWQUPIDNCOVROC-UHFFFAOYSA-N |
| Density | 1.046g/cm3 (Cal.) |
|---|---|
| Boiling point | 425.862°C at 760 mmHg (Cal.) |
| Flash point | 185.432°C (Cal.) |
| Refractive index | 1.527 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 7,17-Dimethylandrostane-3,17-diol |