|
CAS#: 13659-13-7 Product: Benzenesulfonic Acid 4-Bromo-2-Chlorophenyl Ester No suppilers available for the product. |
| Name | Benzenesulfonic Acid 4-Bromo-2-Chlorophenyl Ester |
|---|---|
| Synonyms | (4-Bromo-2-Chloro-Phenyl) Benzenesulfonate; Benzenesulfonic Acid (4-Bromo-2-Chlorophenyl) Ester; Benzenesulfonic Acid (4-Bromo-2-Chloro-Phenyl) Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C12H8BrClO3S |
| Molecular Weight | 347.61 |
| CAS Registry Number | 13659-13-7 |
| SMILES | C1=C(C=CC=C1)[S](=O)(=O)OC2=C(C=C(C=C2)Br)Cl |
| InChI | 1S/C12H8BrClO3S/c13-9-6-7-12(11(14)8-9)17-18(15,16)10-4-2-1-3-5-10/h1-8H |
| InChIKey | BGPWYCOJICYJLI-UHFFFAOYSA-N |
| Density | 1.646g/cm3 (Cal.) |
|---|---|
| Boiling point | 448.265°C at 760 mmHg (Cal.) |
| Flash point | 224.903°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Benzenesulfonic Acid 4-Bromo-2-Chlorophenyl Ester |