|
CAS#: 13801-00-8 Product: 2,3-Dimethyl-6-Nitro-1H-Indole No suppilers available for the product. |
| Name | 2,3-Dimethyl-6-Nitro-1H-Indole |
|---|---|
| Synonyms | 5-20-07-00109 (Beilstein Handbook Reference); Brn 0179788; Indole, 2,3-Dimethyl-6-Nitro- |
| Molecular Structure | ![]() |
| Molecular Formula | C10H10N2O2 |
| Molecular Weight | 190.20 |
| CAS Registry Number | 13801-00-8 |
| SMILES | C1=C([N+]([O-])=O)C=CC2=C1[NH]C(=C2C)C |
| InChI | 1S/C10H10N2O2/c1-6-7(2)11-10-5-8(12(13)14)3-4-9(6)10/h3-5,11H,1-2H3 |
| InChIKey | QQZPUGDUSPXQEI-UHFFFAOYSA-N |
| Density | 1.3g/cm3 (Cal.) |
|---|---|
| Boiling point | 377.242°C at 760 mmHg (Cal.) |
| Flash point | 181.95°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,3-Dimethyl-6-Nitro-1H-Indole |