|
CAS#: 13801-41-7 Product: Thiothenoyltrifluoroacetone No suppilers available for the product. |
| Name | Thiothenoyltrifluoroacetone |
|---|---|
| Synonyms | 1,1,1-Trifluoro-4-(2-Thienyl)-4-Thioxo-Butan-2-One; 1,1,1-Trifluoro-4-(2-Thienyl)-4-Thioxobutan-2-One; 1,1,1-Trifluoro-4-Sulfanylidene-4-Thiophen-2-Yl-Butan-2-One |
| Molecular Structure | ![]() |
| Molecular Formula | C8H5F3OS2 |
| Molecular Weight | 238.24 |
| CAS Registry Number | 13801-41-7 |
| SMILES | C1=C(C(CC(C(F)(F)F)=O)=S)SC=C1 |
| InChI | 1S/C8H5F3OS2/c9-8(10,11)7(12)4-5(13)6-2-1-3-14-6/h1-3H,4H2 |
| InChIKey | SCSSJQAVQJCRQC-UHFFFAOYSA-N |
| Density | 1.445g/cm3 (Cal.) |
|---|---|
| Boiling point | 269.245°C at 760 mmHg (Cal.) |
| Flash point | 116.635°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Thiothenoyltrifluoroacetone |