|
CAS#: 13990-86-8 Product: Dimethoxy Di-p-Cresol No suppilers available for the product. |
| Name | Dimethoxy Di-p-Cresol |
|---|---|
| Synonyms | 2-(2-Hydroxy-3-Methoxy-5-Methyl-Phenyl)-6-Methoxy-4-Methyl-Phenol; (1,1'-Biphenyl)-2,2'-Diol, 3,3'-Dimethoxy-5,5'-Dimethyl-; Dehydrodicresol |
| Molecular Structure | ![]() |
| Molecular Formula | C16H18O4 |
| Molecular Weight | 274.32 |
| CAS Registry Number | 13990-86-8 |
| SMILES | C2=C(C1=CC(=CC(=C1O)OC)C)C(=C(C=C2C)OC)O |
| InChI | 1S/C16H18O4/c1-9-5-11(15(17)13(7-9)19-3)12-6-10(2)8-14(20-4)16(12)18/h5-8,17-18H,1-4H3 |
| InChIKey | QXKAEQCGFVTAMN-UHFFFAOYSA-N |
| Density | 1.182g/cm3 (Cal.) |
|---|---|
| Boiling point | 383.899°C at 760 mmHg (Cal.) |
| Flash point | 185.976°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dimethoxy Di-p-Cresol |