|
CAS#: 13997-29-0 Product: 4-Amino-2-Chloro-5-(2,4,5-Trichlorophenoxy)Phenyl Thiocyanate No suppilers available for the product. |
| Name | 4-Amino-2-Chloro-5-(2,4,5-Trichlorophenoxy)Phenyl Thiocyanate |
|---|---|
| Synonyms | 4-Amino-2 |
| Molecular Structure | ![]() |
| Molecular Formula | C13H6Cl4N2OS |
| Molecular Weight | 380.08 |
| CAS Registry Number | 13997-29-0 |
| SMILES | Clc2cc(Oc1cc(SC#N)c(Cl)cc1N)c(Cl)cc2Cl |
| InChI | 1S/C13H6Cl4N2OS/c14-6-1-8(16)11(3-7(6)15)20-12-4-13(21-5-18)9(17)2-10(12)19/h1-4H,19H2 |
| InChIKey | KPNRBRAYWRNRPO-UHFFFAOYSA-N |
| Density | 1.67g/cm3 (Cal.) |
|---|---|
| Boiling point | 447.706°C at 760 mmHg (Cal.) |
| Flash point | 224.565°C (Cal.) |
| Refractive index | 1.708 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Amino-2-Chloro-5-(2,4,5-Trichlorophenoxy)Phenyl Thiocyanate |