|
CAS#: 140701-33-3 Product: 1a,11-Dihydroindeno(7',1':6,7,8)Phenanthro(1,2-b)Oxirene No suppilers available for the product. |
| Name | 1a,11-Dihydroindeno(7',1':6,7,8)Phenanthro(1,2-b)Oxirene |
|---|---|
| Synonyms | 9,10-Epoxy-9,10-Dihydrobenz(J)Aceanthrylene; Brn 4258117; Benz(J)Aceanthrylene 9,10-Epoxide |
| Molecular Structure | ![]() |
| Molecular Formula | C20H12O |
| Molecular Weight | 268.31 |
| CAS Registry Number | 140701-33-3 |
| SMILES | C4=C3C2=C(C1OC1C=C2)C=CC3=C6C5=C4C=CC=C5C=C6 |
| InChI | 1S/C20H12O/c1-2-11-4-5-15-13-6-7-16-14(8-9-18-20(16)21-18)17(13)10-12(3-1)19(11)15/h1-10,18,20H |
| InChIKey | WSBNMAGTIVSKFH-UHFFFAOYSA-N |
| Density | 1.396g/cm3 (Cal.) |
|---|---|
| Boiling point | 536.602°C at 760 mmHg (Cal.) |
| Flash point | 257.823°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1a,11-Dihydroindeno(7',1':6,7,8)Phenanthro(1,2-b)Oxirene |