|
CAS#: 14090-52-9 Product: 2-Acetyl-3,5-Dihydroxy-6,8-Dimethoxy-1,4-Naphthoquinone No suppilers available for the product. |
| Name | 2-Acetyl-3,5-Dihydroxy-6,8-Dimethoxy-1,4-Naphthoquinone |
|---|---|
| Synonyms | 2-Acetyl-3,5-dihydroxy-6,8-dimethoxynaphthoquinone # |
| Molecular Structure | ![]() |
| Molecular Formula | C14H12O7 |
| Molecular Weight | 292.24 |
| CAS Registry Number | 14090-52-9 |
| SMILES | CC(=O)C=2C(=O)c1c(cc(OC)c(O)c1C(=O)C=2O)OC |
| InChI | 1S/C14H12O7/c1-5(15)8-12(17)9-6(20-2)4-7(21-3)11(16)10(9)14(19)13(8)18/h4,16,18H,1-3H3 |
| InChIKey | UHEQVVUQWUSVPH-UHFFFAOYSA-N |
| Density | 1.513g/cm3 (Cal.) |
|---|---|
| Boiling point | 599.373°C at 760 mmHg (Cal.) |
| Flash point | 231.143°C (Cal.) |
| Refractive index | (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Acetyl-3,5-Dihydroxy-6,8-Dimethoxy-1,4-Naphthoquinone |