Online Database of Chemicals from Around the World
|
CAS#: 141272-44-8 Product: Xeatobergsterol B No suppilers available for the product. |
| Name | Xeatobergsterol B |
|---|---|
| Synonyms | Aids-057287; Aids057287; Xestobergsterol B |
| Molecular Structure |  |
| Molecular Formula | C27H44O7 |
| Molecular Weight | 480.64 |
| CAS Registry Number | 141272-44-8 |
| SMILES | [C@H]15[C@H](C(=O)[C@H]2[C@@]1(CCC3C2[C@@H](O)[C@H](O)[C@@H]4[C@@]3([C@H](O)[C@H](O)[C@@H](O)C4)C)C)[C@](O)(C[C@H]5C)CC(C)C |
| InChI | 1S/C27H44O7/c1-11(2)9-27(34)10-12(3)17-19(27)23(32)18-16-13(6-7-25(17,18)4)26(5)14(20(29)22(16)31)8-15(28)21(30)24(26)33/h11-22,24,28-31,33-34H,6-10H2,1-5H3/t12-,13?,14-,15+,16?,17+,18+,19-,20-,21-,22-,24-,25-,26-,27-/m1/s1 |
| InChIKey | DGXRPSIAVFYMOL-NFUSMCCKSA-N |
| Density | 1.278g/cm3 (Cal.) |
|---|---|
| Boiling point | 618.896°C at 760 mmHg (Cal.) |
| Flash point | 342.112°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Xeatobergsterol B |