|
CAS#: 14155-76-1 Product: Buxaminol E No suppilers available for the product. |
| Name | Buxaminol E |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C26H44N2O |
| Molecular Weight | 400.65 |
| CAS Registry Number | 14155-76-1 |
| SMILES | [C@@]12([C@@]([C@H]([C@H](O)C1)[C@@H](N)C)(CC=C3[C@H]2CC[C@@H]4C(=C3)CC[C@H](N(C)C)C4(C)C)C)C |
| InChI | 1S/C26H44N2O/c1-16(27)23-21(29)15-26(5)20-10-9-19-17(14-18(20)12-13-25(23,26)4)8-11-22(28(6)7)24(19,2)3/h12,14,16,19-23,29H,8-11,13,15,27H2,1-7H3/t16-,19+,20+,21+,22-,23-,25+,26-/m0/s1 |
| InChIKey | AJPLABZESIJHMG-OTKPAKDNSA-N |
| Density | 1.06g/cm3 (Cal.) |
|---|---|
| Boiling point | 521.715°C at 760 mmHg (Cal.) |
| Flash point | 269.324°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Buxaminol E |