|
CAS#: 141869-53-6 Product: Pradimicin Q No suppilers available for the product. |
| Name | Pradimicin Q |
|---|---|
| Synonyms | Aids027890; Benzo[A]Naphthacene-2-Carboxylic Acid, 5,6,8,13-Tetrahydro-1,5,7,9,11,14-Hexahydroxy-3-Methyl-8,13-Dioxo-; Benzo(A)Naphthacene-2-Carboxylic Acid, 5,6,8,13-Tetrahydro-1,5,7,9,11,14-Hexahydroxy-3-Methyl-8,13-Dioxo- |
| Molecular Structure | ![]() |
| Molecular Formula | C24H16O10 |
| Molecular Weight | 464.38 |
| CAS Registry Number | 141869-53-6 |
| SMILES | [C@H]2(O)C5=C(C1=C(O)C3=C(C(=C1C2)O)C(=O)C4=C(C3=O)C=C(O)C=C4O)C(=C(C(=C5)C)C(=O)O)O |
| InChI | 1S/C24H16O10/c1-6-2-8-11(26)5-10-16(15(8)21(30)13(6)24(33)34)23(32)18-17(20(10)29)22(31)14-9(19(18)28)3-7(25)4-12(14)27/h2-4,11,25-27,29-30,32H,5H2,1H3,(H,33,34)/t11-/m1/s1 |
| InChIKey | QJLPWVUZFKETMK-LLVKDONJSA-N |
| Density | 1.831g/cm3 (Cal.) |
|---|---|
| Boiling point | 885.191°C at 760 mmHg (Cal.) |
| Flash point | 502.983°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Pradimicin Q |