|
CAS#: 142184-78-9 Product: (+-)-cis-5,6,7,8-Diepoxy-5,6,7,8-Tetrahydroquinoline No suppilers available for the product. |
| Name | (+-)-cis-5,6,7,8-Diepoxy-5,6,7,8-Tetrahydroquinoline |
|---|---|
| Synonyms | Bisoxireno(F,H)Quinoline, 1A,1B,2A,6B-Tetrahydro-, (1Aalpha,1Balpha,2Aalpha,6Balpha)-(+-)-; Ccris 4441; Cis-Quinoline-5,6,7,8-Dioxide |
| Molecular Structure | ![]() |
| Molecular Formula | C9H7NO2 |
| Molecular Weight | 161.16 |
| CAS Registry Number | 142184-78-9 |
| SMILES | [C@H]23C1=C(N=CC=C1)C4C([C@H]2O3)O4 |
| InChI | 1S/C9H7NO2/c1-2-4-5(10-3-1)7-9(12-7)8-6(4)11-8/h1-3,6-9H/t6-,7?,8-,9?/m0/s1 |
| InChIKey | DLTXKFCMJDWKEV-KJMVCIMSSA-N |
| Density | 1.477g/cm3 (Cal.) |
|---|---|
| Boiling point | 338.409°C at 760 mmHg (Cal.) |
| Flash point | 123.81°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (+-)-cis-5,6,7,8-Diepoxy-5,6,7,8-Tetrahydroquinoline |