|
CAS#: 14221-65-9 Product: 3,5-Dihydroxy-6,7,8-Trimethoxy-2-Phenyl-4H-1-Benzopyran-4-One No suppilers available for the product. |
| Name | 3,5-Dihydroxy-6,7,8-Trimethoxy-2-Phenyl-4H-1-Benzopyran-4-One |
|---|---|
| Synonyms | 3,5-Dihydroxy-6,7,8-Trimethoxy-2-Phenyl-Chromen-4-One; 3,5-Dihydroxy-6,7,8-Trimethoxy-2-Phenyl-4-Chromenone; 3,5-Dihydroxy-6,7,8-Trimethoxy-2-Phenyl-Chromone |
| Molecular Structure | ![]() |
| Molecular Formula | C18H16O7 |
| Molecular Weight | 344.32 |
| CAS Registry Number | 14221-65-9 |
| SMILES | C1=CC=CC=C1C3=C(C(C2=C(C(=C(OC)C(=C2O3)OC)OC)O)=O)O |
| InChI | 1S/C18H16O7/c1-22-16-12(20)10-11(19)13(21)14(9-7-5-4-6-8-9)25-15(10)17(23-2)18(16)24-3/h4-8,20-21H,1-3H3 |
| InChIKey | TYZXGIOTNSBKDB-UHFFFAOYSA-N |
| Density | 1.407g/cm3 (Cal.) |
|---|---|
| Boiling point | 579.736°C at 760 mmHg (Cal.) |
| Flash point | 213.15°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,5-Dihydroxy-6,7,8-Trimethoxy-2-Phenyl-4H-1-Benzopyran-4-One |