|
CAS#: 14225-07-1 Product: Leucodrin No suppilers available for the product. |
| Name | Leucodrin |
|---|---|
| Synonyms | 7-(1,2-Dihydroxyethyl)-6-Hydroxy-4-(4-Hydroxyphenyl)-1,8-Dioxaspiro[4.4]Nonane-2,9-Quinone; 1,7-Dioxaspiro[4.4]Nonane-2,6-Dione, 8-(1,2-Dihydroxyethyl)-9-Hydroxy-4-(4-Hydroxyphenyl)-, [5S-[5.Alpha.(S*),8.Alpha.(R*),9.Beta.]]-; 1,7-Dioxaspiro[4.4]Nonane-2,6-Dione, 8-(1,2-Dihydroxyethyl)-9-Hydroxy-4-(P-Hydroxyphenyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C15H16O8 |
| Molecular Weight | 324.29 |
| CAS Registry Number | 14225-07-1 |
| SMILES | C3=C(C2C1(C(OC(C1O)C(O)CO)=O)OC(=O)C2)C=CC(=C3)O |
| InChI | 1S/C15H16O8/c16-6-10(18)12-13(20)15(14(21)22-12)9(5-11(19)23-15)7-1-3-8(17)4-2-7/h1-4,9-10,12-13,16-18,20H,5-6H2 |
| InChIKey | JVCLQSJXGOABTC-UHFFFAOYSA-N |
| Density | 1.632g/cm3 (Cal.) |
|---|---|
| Boiling point | 747.73°C at 760 mmHg (Cal.) |
| Flash point | 282.678°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Leucodrin |