|
CAS#: 14226-68-7 Product: 5-(Benzyloxy)-3-(1-Methyl-2-Pyrrolidinyl)-1H-Indole No suppilers available for the product. |
| Name | 5-(Benzyloxy)-3-(1-Methyl-2-Pyrrolidinyl)-1H-Indole |
|---|---|
| Synonyms | 3-(1-Methyl-2-Pyrrolidinyl)-5-(Phenylmethoxy)-1H-Indole; 5-(Benzyloxy)-3-(1-Methylpyrrolidin-2-Yl)-1H-Indole; 5-23-12-00064 (Beilstein Handbook Reference) |
| Molecular Structure | ![]() |
| Molecular Formula | C20H22N2O |
| Molecular Weight | 306.41 |
| CAS Registry Number | 14226-68-7 |
| SMILES | C1=C(C=CC2=C1C(=C[NH]2)C3N(CCC3)C)OCC4=CC=CC=C4 |
| InChI | 1S/C20H22N2O/c1-22-11-5-8-20(22)18-13-21-19-10-9-16(12-17(18)19)23-14-15-6-3-2-4-7-15/h2-4,6-7,9-10,12-13,20-21H,5,8,11,14H2,1H3 |
| InChIKey | SLFSSUKLMIHWLW-UHFFFAOYSA-N |
| Density | 1.174g/cm3 (Cal.) |
|---|---|
| Boiling point | 487.854°C at 760 mmHg (Cal.) |
| Flash point | 248.846°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-(Benzyloxy)-3-(1-Methyl-2-Pyrrolidinyl)-1H-Indole |