|
CAS#: 143789-15-5 Product: Methyl (2S,3S)-2-Methoxytetrahydro-3-Furancarboxylate No suppilers available for the product. |
| Name | Methyl (2S,3S)-2-Methoxytetrahydro-3-Furancarboxylate |
|---|---|
| Synonyms | (2S,3S)-methyl 2-methoxytetrahydrofuran-3-carboxylate |
| Molecular Structure | ![]() |
| Molecular Formula | C7H12O4 |
| Molecular Weight | 160.17 |
| CAS Registry Number | 143789-15-5 |
| SMILES | CO[C@@H]1[C@H](CCO1)C(=O)OC |
| InChI | 1S/C7H12O4/c1-9-6(8)5-3-4-11-7(5)10-2/h5,7H,3-4H2,1-2H3/t5-,7+/m1/s1 |
| InChIKey | QWUVZLCBSCYPBK-VDTYLAMSSA-N |
| Density | 1.119g/cm3 (Cal.) |
|---|---|
| Boiling point | 195.656°C at 760 mmHg (Cal.) |
| Flash point | 74.803°C (Cal.) |
| Refractive index | 1.44 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl (2S,3S)-2-Methoxytetrahydro-3-Furancarboxylate |