|
CAS#: 14419-01-3 Product: Methyl 2,3,5,6-tetrachloro-4-(methoxy-methylcarbamoyl)benzoate No suppilers available for the product. |
| Name | Methyl 2,3,5,6-tetrachloro-4-(methoxy-methylcarbamoyl)benzoate |
|---|---|
| Synonyms | Methyl 2,3,5,6-Tetrachloro-4-(Methoxy-Methyl-Carbamoyl)Benzoate; 2,3,5,6-Tetrachloro-4-[(Methoxy-Methylamino)-Oxomethyl]Benzoic Acid Methyl Ester; 2,3,5,6-Tetrachloro-4-(Methoxy-Methyl-Carbamoyl)Benzoic Acid Methyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C11H9Cl4NO4 |
| Molecular Weight | 361.01 |
| CAS Registry Number | 14419-01-3 |
| SMILES | CN(C(C1=C(C(=C(C(OC)=O)C(=C1Cl)Cl)Cl)Cl)=O)OC |
| InChI | 1S/C11H9Cl4NO4/c1-16(20-3)10(17)4-6(12)8(14)5(11(18)19-2)9(15)7(4)13/h1-3H3 |
| InChIKey | CWOBGOXHYZMVNY-UHFFFAOYSA-N |
| Density | 1.525g/cm3 (Cal.) |
|---|---|
| Boiling point | 501.467°C at 760 mmHg (Cal.) |
| Flash point | 257.078°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl 2,3,5,6-tetrachloro-4-(methoxy-methylcarbamoyl)benzoate |