| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| Santa Cruz Biotechnology, Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (831) 457-3800 | |||
![]() |
scbt@scbt.com | |||
| Chemical manufacturer | ||||
| Sigma-Aldrich, Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (21) 6141-5566 / 800-819-3336 | |||
![]() |
ordercn@sial.com, | |||
| Chemical manufacturer since 1992 | ||||
| Classification | Biochemical >> Amino acids and their derivatives >> Amino alcohol derivative |
|---|---|
| Name | (1R)-2-[(2-Methyl-2-Propanyl)Amino]-1-Phenylethanol |
| Synonyms | - -2-TERT-BUTYLAMINO-1-PHENYLETHAN&; (R)-(-)-2-tert-Butylamino-1-phenylethanol; (R)-(−)-2-tert-Butylamino-1-phenylethanol |
| Molecular Structure | ![]() |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 |
| CAS Registry Number | 14467-51-7 |
| SMILES | O[C@@H](CNC(C)(C)C)c1ccccc1 |
| InChI | 1S/C12H19NO/c1-12(2,3)13-9-11(14)10-7-5-4-6-8-10/h4-8,11,13-14H,9H2,1-3H3/t11-/m0/s1 |
| InChIKey | NRVOOKOHYKJCPB-NSHDSACASA-N |
| Density | 0.989g/cm3 (Cal.) |
|---|---|
| Boiling point | 283.999°C at 760 mmHg (Cal.) |
| Flash point | 80.656°C (Cal.) |
| Refractive index | 1.52 (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for (1R)-2-[(2-Methyl-2-Propanyl)Amino]-1-Phenylethanol |