|
CAS#: 145-95-9 Product: 3-Hydroxy-7H-Purine-6-Thione No suppilers available for the product. |
| Name | 3-Hydroxy-7H-Purine-6-Thione |
|---|---|
| Synonyms | Nsc528013; 6H-Purine-6-Thione, 1,7-Dihydro-, 3-Oxide; 6-Mercaptopurine-3-N-Oxide |
| Molecular Structure | ![]() |
| Molecular Formula | C5H4N4OS |
| Molecular Weight | 168.17 |
| CAS Registry Number | 145-95-9 |
| SMILES | C1=NC2=C([NH]1)C(=S)N=CN2O |
| InChI | 1S/C5H4N4OS/c10-9-2-8-5(11)3-4(9)7-1-6-3/h1-2,10H,(H,6,7) |
| InChIKey | KQVFSGYPMZGDGT-UHFFFAOYSA-N |
| Density | 1.937g/cm3 (Cal.) |
|---|---|
| Boiling point | 583.235°C at 760 mmHg (Cal.) |
| Flash point | 306.53°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Hydroxy-7H-Purine-6-Thione |