|
CAS#: 14599-36-1 Product: Mefruside Lactone No suppilers available for the product. |
| Name | Mefruside Lactone |
|---|---|
| Synonyms | 4-Chloro-N-Methyl-N-[(2-Methyl-5-Oxo-Tetrahydrofuran-2-Yl)Methyl]Benzene-1,3-Disulfonamide; 4-Chloro-N-Methyl-N-[(2-Methyl-5-Oxo-2-Tetrahydrofuranyl)Methyl]Benzene-1,3-Disulfonamide; 4-Chloro-N-[(5-Keto-2-Methyl-Tetrahydrofuran-2-Yl)Methyl]-N-Methyl-Benzene-1,3-Disulfonamide |
| Molecular Structure | ![]() |
| Molecular Formula | C13H17ClN2O6S2 |
| Molecular Weight | 396.86 |
| CAS Registry Number | 14599-36-1 |
| SMILES | C1=C(C(=CC=C1[S](=O)(=O)N(CC2(OC(CC2)=O)C)C)Cl)[S](=O)(=O)N |
| InChI | 1S/C13H17ClN2O6S2/c1-13(6-5-12(17)22-13)8-16(2)24(20,21)9-3-4-10(14)11(7-9)23(15,18)19/h3-4,7H,5-6,8H2,1-2H3,(H2,15,18,19) |
| InChIKey | UBRIMIXGZCAQOY-UHFFFAOYSA-N |
| Density | 1.489g/cm3 (Cal.) |
|---|---|
| Boiling point | 637.106°C at 760 mmHg (Cal.) |
| Flash point | 339.11°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Mefruside Lactone |