|
CAS#: 145079-98-7 Product: L-Ascorbic acid 2-(glycyrrhetic acid ethyl ester-3beta-yl)phosphate sodium salt No suppilers available for the product. |
| Name | L-Ascorbic acid 2-(glycyrrhetic acid ethyl ester-3beta-yl)phosphate sodium salt |
|---|---|
| Synonyms | Ascorbic Acid 2-(11-Oxoolean-12-En-29-Oic Acid Ethyl Ester 3-Yl-Phosphate); Gepc; L-Ascorbic Acid 2-(Glycyrrhetic Acid Ethyl Ester-3Beta-Yl)Phosphate Sodium Salt |
| Molecular Structure | ![]() |
| Molecular Formula | C41H61O12P |
| Molecular Weight | 776.90 |
| CAS Registry Number | 145079-98-7 |
| SMILES | C(OC(=O)C3(CC2C1=CC(=O)C4C(C1(CCC2(CC3)C)C)(CCC7C4(CCC(O[P](OC5=C(OC(C5=O)C6OC(OC6)(C)C)O)(O)=O)C7(C)C)C)C)C)C |
| InChI | 1S/C41H61O12P/c1-11-48-34(45)38(7)17-16-37(6)18-19-40(9)23(24(37)21-38)20-25(42)32-39(8)14-13-28(35(2,3)27(39)12-15-41(32,40)10)52-54(46,47)53-31-29(43)30(50-33(31)44)26-22-49-36(4,5)51-26/h20,24,26-28,30,32,44H,11-19,21-22H2,1-10H3,(H,46,47) |
| InChIKey | WNFUWBBZIAIKSE-UHFFFAOYSA-N |
| Density | 1.289g/cm3 (Cal.) |
|---|---|
| Boiling point | 761.172°C at 760 mmHg (Cal.) |
| Flash point | 414.142°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for L-Ascorbic acid 2-(glycyrrhetic acid ethyl ester-3beta-yl)phosphate sodium salt |