|
CAS#: 14528-48-4 Product: (8alpha,9R)-9-Chloro-6'-Methoxycinchonan No suppilers available for the product. |
| Name | (8alpha,9R)-9-Chloro-6'-Methoxycinchonan |
|---|---|
| Synonyms | 4-[(R)-Chloro-[(2S,4S,5R)-5-Vinylquinuclidin-2-Yl]Methyl]-6-Methoxy-Quinoline; 4-[(R)-Chloro-[(2S,4S,5R)-5-Vinyl-2-Quinuclidinyl]Methyl]-6-Methoxyquinoline; 4-[(R)-Chloro-[(4S,5R,7S)-5-Ethenyl-1-Azabicyclo[2.2.2]Octan-7-Yl]Methyl]-6-Methoxy-Quinoline |
| Molecular Structure | ![]() |
| Molecular Formula | C20H23ClN2O |
| Molecular Weight | 342.87 |
| CAS Registry Number | 14528-48-4 |
| EINECS | 238-546-9 |
| SMILES | [C@@H]14[C@H](CN([C@@H](C1)[C@H](Cl)C2=C3C(=NC=C2)C=CC(=C3)OC)CC4)C=C |
| InChI | 1S/C20H23ClN2O/c1-3-13-12-23-9-7-14(13)10-19(23)20(21)16-6-8-22-18-5-4-15(24-2)11-17(16)18/h3-6,8,11,13-14,19-20H,1,7,9-10,12H2,2H3/t13-,14-,19-,20+/m0/s1 |
| InChIKey | KQRKDUSVAAFOOA-WZBLMQSHSA-N |
| Density | 1.223g/cm3 (Cal.) |
|---|---|
| Boiling point | 482.808°C at 760 mmHg (Cal.) |
| Flash point | 245.794°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (8alpha,9R)-9-Chloro-6'-Methoxycinchonan |