|
CAS#: 1460-43-1 Product: 3-Amino-2,4,6-Triiodobenzyl Alcohol No suppilers available for the product. |
| Name | 3-Amino-2,4,6-Triiodobenzyl Alcohol |
|---|---|
| Synonyms | (3-Amino-2,4,6-Triiodo-Phenyl)Methanol; 3-Amino-2,4,6-Triiodobenzyl Alcohol; Benzyl Alcohol, 3-Amino-2,4,6-Triiodo- |
| Molecular Structure | ![]() |
| Molecular Formula | C7H6I3NO |
| Molecular Weight | 500.84 |
| CAS Registry Number | 1460-43-1 |
| SMILES | C1=C(C(=C(C(=C1I)CO)I)N)I |
| InChI | 1S/C7H6I3NO/c8-4-1-5(9)7(11)6(10)3(4)2-12/h1,12H,2,11H2 |
| InChIKey | VZQXILUNJAYEEK-UHFFFAOYSA-N |
| Density | 2.916g/cm3 (Cal.) |
|---|---|
| Boiling point | 473.478°C at 760 mmHg (Cal.) |
| Flash point | 240.151°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Amino-2,4,6-Triiodobenzyl Alcohol |