| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | N,N-Dimethyl-3-[2-(Trifluoromethyl)Phenothiazin-10-Yl]Propan-1-Amine |
|---|---|
| Synonyms | N,N-Dimethyl-3-[2-(Trifluoromethyl)-10-Phenothiazinyl]Propan-1-Amine; Dimethyl-[3-[2-(Trifluoromethyl)Phenothiazin-10-Yl]Propyl]Amine; Bpbio1_000227 |
| Molecular Structure | ![]() |
| Molecular Formula | C18H19F3N2S |
| Molecular Weight | 352.42 |
| CAS Registry Number | 146-54-3 |
| EINECS | 205-673-6 |
| SMILES | C1=C(C(F)(F)F)C=CC2=C1N(C3=C(S2)C=CC=C3)CCCN(C)C |
| InChI | 1S/C18H19F3N2S/c1-22(2)10-5-11-23-14-6-3-4-7-16(14)24-17-9-8-13(12-15(17)23)18(19,20)21/h3-4,6-9,12H,5,10-11H2,1-2H3 |
| InChIKey | XSCGXQMFQXDFCW-UHFFFAOYSA-N |
| Density | 1.2±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 427.6±45.0°C at 760 mmHg (Cal.) |
| Flash point | 212.4±28.7°C (Cal.) |
| (1) | Eduardo Costa Figueiredo, Gustavo Braga Sanvido, Marco Aurélio Zezzi Arruda and Marcos Nogueira Eberlin. Molecularly imprinted polymers as analyte sequesters and selective surfaces for easy ambient sonic-spray ionization, Analyst, 2010, 135, 726. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for N,N-Dimethyl-3-[2-(Trifluoromethyl)Phenothiazin-10-Yl]Propan-1-Amine |