|
CAS#: 14656-06-5 Product: 1,1,3,5-Tetramethyl-1H-Indene No suppilers available for the product. |
| Name | 1,1,3,5-Tetramethyl-1H-Indene |
|---|---|
| Synonyms | 1,1,3,5-Tetramethyl-1H-Indene |
| Molecular Structure | ![]() |
| Molecular Formula | C13H16 |
| Molecular Weight | 172.27 |
| CAS Registry Number | 14656-06-5 |
| EINECS | 238-703-1 |
| SMILES | C1=CC(=CC2=C1C(C=C2C)(C)C)C |
| InChI | 1S/C13H16/c1-9-5-6-12-11(7-9)10(2)8-13(12,3)4/h5-8H,1-4H3 |
| InChIKey | OIPWFYHULPYGNG-UHFFFAOYSA-N |
| Density | 0.934g/cm3 (Cal.) |
|---|---|
| Boiling point | 242.643°C at 760 mmHg (Cal.) |
| Flash point | 95.099°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,1,3,5-Tetramethyl-1H-Indene |