|
CAS#: 14609-74-6 Product: 4-Nitrophenol anion No suppilers available for the product. |
| Name | 4-Nitrophenol anion |
|---|---|
| Synonyms | 4-Nitrophenol Ion(1-); 4-Nitrophenolate; 4-Nitrophenoxide |
| Molecular Structure | ![]() |
| Molecular Formula | C6H4NO3 |
| Molecular Weight | 138.10 |
| CAS Registry Number | 14609-74-6 |
| SMILES | C1=C([N+]([O-])=O)C=CC(=C1)[O-] |
| InChI | 1S/C6H5NO3/c8-6-3-1-5(2-4-6)7(9)10/h1-4,8H/p-1 |
| InChIKey | BTJIUGUIPKRLHP-UHFFFAOYSA-M |
| Boiling point | 278.999°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 141.896°C (Cal.) |
| (1) | Jina Yoo, Sung Jae Na, Hyeong Cheol Park, Anish Cyriac and Bun Yeoul Lee. Anion variation on a cobalt(iii) complex of salen-type ligand tethered by four quaternary ammonium salts for CO/epoxide copolymerization, Dalton Trans., 2010, 39, 2622. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 4-Nitrophenol anion |