|
CAS#: 1461-03-6 Product: Himachalene No suppilers available for the product. |
| Name | Himachalene |
|---|---|
| Synonyms | 1H-Benzocycloheptene, 2,4A,5,6,7,8-Hexahydro-3,5,5,9-Tetramethyl-, (R)-; 1H-Benzocycloheptene, 2,4A.Beta.,5,6,7,8-Hexahydro-3,5,5,9-Tetramethyl-, (+)-; 1H-Benzocycloheptene, 2,4Abeta,5,6,7,8-Hexahydro-3,5,5,9-Tetramethyl-, (+)- |
| Molecular Structure | ![]() |
| Molecular Formula | C15H24 |
| Molecular Weight | 204.35 |
| CAS Registry Number | 1461-03-6 |
| SMILES | CC1(C2C(=C(CCC1)C)CCC(=C2)C)C |
| InChI | 1S/C15H24/c1-11-7-8-13-12(2)6-5-9-15(3,4)14(13)10-11/h10,14H,5-9H2,1-4H3 |
| InChIKey | LCOSCMLXPAQCLQ-UHFFFAOYSA-N |
| Density | 0.905g/cm3 (Cal.) |
|---|---|
| Boiling point | 275.911°C at 760 mmHg (Cal.) |
| Flash point | 108.628°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Himachalene |