| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (650) 278-9963 | |||
![]() |
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| P and M Invest Ltd. | Russian Federation | Inquire | ||
|---|---|---|---|---|
![]() |
+7 (495) 135-6494 | |||
![]() |
sales@fluorine.ru | |||
| Chemical manufacturer | ||||
| SynQuest Labs, Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (386) 462-0788 | |||
![]() |
info@synquestlabs.com | |||
| Chemical manufacturer | ||||
| Zylexa Pharma Ltd. | UK | Inquire | ||
|---|---|---|---|---|
![]() |
+44 (845) 299-6009/ | |||
![]() |
sales@zylexa-pharma.com,enquiries@zylexa-pharma.com | |||
| Chemical manufacturer | ||||
| Name | 1H,1H-Perfluoro-2,5,8-Trimethyl-3,6,9-Trioxadodecan-1-Ol |
|---|---|
| Synonyms | 1H,1H-Perfluoro-2,5,8-Trimethyl-3,6,9-Trioxaundecan-1-Ol |
| Molecular Structure | ![]() |
| Molecular Formula | C12H3F23O4 |
| Molecular Weight | 648.12 |
| CAS Registry Number | 14620-81-6 |
| SMILES | C(C(OC(C(OC(C(OC(C(C(F)(F)F)(F)F)(F)F)(F)C(F)(F)F)(F)F)(C(F)(F)F)F)(F)F)(C(F)(F)F)F)O |
| InChI | 1S/C12H3F23O4/c13-2(1-36,6(18,19)20)37-11(32,33)4(16,8(24,25)26)39-12(34,35)5(17,9(27,28)29)38-10(30,31)3(14,15)7(21,22)23/h36H,1H2 |
| InChIKey | IVWMVBZXKIOILW-UHFFFAOYSA-N |
| Density | 1.756g/cm3 (Cal.) |
|---|---|
| Boiling point | 70°C (Expl.) |
| 319.56°C at 760 mmHg (Cal.) | |
| Flash point | 150.524°C (Cal.) |
| Refractive index | 1.3069 (Expl.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1H,1H-Perfluoro-2,5,8-Trimethyl-3,6,9-Trioxadodecan-1-Ol |