|
CAS#: 1463-28-1 Product: Guanacline No suppilers available for the product. |
| Name | Guanacline |
|---|---|
| Synonyms | Guanacline Monosulfate; Guanacline Sulfate Anhydrous |
| Molecular Structure | ![]() |
| Molecular Formula | C9H20N4O4S |
| Molecular Weight | 280.34 |
| CAS Registry Number | 1463-28-1 (1562-71-6) |
| EINECS | 216-344-1 |
| SMILES | O=[S](O)(O)=O.C(N1CCC(C=C1)C)CN=C(N)N |
| InChI | 1S/C9H18N4.H2O4S/c1-8-2-5-13(6-3-8)7-4-12-9(10)11;1-5(2,3)4/h2,5,8H,3-4,6-7H2,1H3,(H4,10,11,12);(H2,1,2,3,4) |
| InChIKey | USBAPRNMXVPJEX-UHFFFAOYSA-N |
| Boiling point | 344°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 161.8°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Guanacline |