|
CAS#: 14658-94-7 Product: 1,3-Dichloro-Azulene No suppilers available for the product. |
| Name | 1,3-Dichloro-Azulene |
|---|---|
| Synonyms | Azulene,1,3-Dichloro-; Azulene, 1,3-Dichloro- |
| Molecular Structure | ![]() |
| Molecular Formula | C10H6Cl2 |
| Molecular Weight | 197.06 |
| CAS Registry Number | 14658-94-7 |
| SMILES | C2(=C1C(=CC=CC=C1)C(=C2)Cl)Cl |
| InChI | 1S/C10H6Cl2/c11-9-6-10(12)8-5-3-1-2-4-7(8)9/h1-6H |
| InChIKey | WHRWUFQUMNUVQH-UHFFFAOYSA-N |
| Density | 1.336g/cm3 (Cal.) |
|---|---|
| Boiling point | 295.609°C at 760 mmHg (Cal.) |
| Flash point | 139.529°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,3-Dichloro-Azulene |