|
CAS#: 1470-35-5 Product: Isobromindione No suppilers available for the product. |
| Name | Isobromindione |
|---|---|
| Synonyms | 5-Bromo-2-Phenyl-Indane-1,3-Dione; 5-Bromo-2-Phenylindane-1,3-Dione; 5-Bromo-2-Phenyl-Indane-1,3-Quinone |
| Molecular Structure | ![]() |
| Molecular Formula | C15H9BrO2 |
| Molecular Weight | 301.14 |
| CAS Registry Number | 1470-35-5 |
| EINECS | 216-000-0 |
| SMILES | C1=CC=CC=C1C2C(C3=C(C2=O)C=CC(=C3)Br)=O |
| InChI | 1S/C15H9BrO2/c16-10-6-7-11-12(8-10)15(18)13(14(11)17)9-4-2-1-3-5-9/h1-8,13H |
| InChIKey | QFLZIWVSQDZLNW-UHFFFAOYSA-N |
| Density | 1.569g/cm3 (Cal.) |
|---|---|
| Boiling point | 468.491°C at 760 mmHg (Cal.) |
| Flash point | 161.827°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Isobromindione |