|
CAS#: 147465-43-8 Product: N-[[4-(2,3-Dihydroxypropyl)-3-Methoxyphenyl]Methyl]Nonanamide No suppilers available for the product. |
| Name | N-[[4-(2,3-Dihydroxypropyl)-3-Methoxyphenyl]Methyl]Nonanamide |
|---|---|
| Synonyms | N-[[4-(2,3-Dihydroxypropyl)-3-Methoxy-Phenyl]Methyl]Nonanamide; N-(4-Glyceryl-3-Methoxy-Benzyl)Pelargonamide; Glyceryl Nonivamide |
| Molecular Structure | ![]() |
| Molecular Formula | C20H33NO4 |
| Molecular Weight | 351.49 |
| CAS Registry Number | 147465-43-8 |
| SMILES | C1=C(C(=CC=C1CNC(CCCCCCCC)=O)CC(CO)O)OC |
| InChI | 1S/C20H33NO4/c1-3-4-5-6-7-8-9-20(24)21-14-16-10-11-17(13-18(23)15-22)19(12-16)25-2/h10-12,18,22-23H,3-9,13-15H2,1-2H3,(H,21,24) |
| InChIKey | ZPRQZUALRQVYOJ-UHFFFAOYSA-N |
| Density | 1.068g/cm3 (Cal.) |
|---|---|
| Boiling point | 581.757°C at 760 mmHg (Cal.) |
| Flash point | 305.636°C (Cal.) |
| (1) | William Bains, Antranig Basman and Cat White. hERG binding specificity and binding site structure: evidence from a fragment-based evolutionary computing SAR study, Progress in Biophysics and Molecular Biology 2004, 86 (2), 205-233 |
|---|---|
| Market Analysis Reports |
| List of Reports Available for N-[[4-(2,3-Dihydroxypropyl)-3-Methoxyphenyl]Methyl]Nonanamide |