|
CAS#: 148-19-6 Product: 3-Hydroxy-3-Methyl-2-Phenylpentanoic Acid No suppilers available for the product. |
| Name | 3-Hydroxy-3-Methyl-2-Phenylpentanoic Acid |
|---|---|
| Synonyms | 3-Hydroxy-3-Methyl-2-Phenyl-Pentanoic Acid; 3-Hydroxy-3-Methyl-2-Phenyl-Valeric Acid; 2-Phenyl-3-Methyl-3-Hydroxypentanoic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.26 |
| CAS Registry Number | 148-19-6 |
| SMILES | C1=CC=CC=C1C(C(CC)(C)O)C(O)=O |
| InChI | 1S/C12H16O3/c1-3-12(2,15)10(11(13)14)9-7-5-4-6-8-9/h4-8,10,15H,3H2,1-2H3,(H,13,14) |
| InChIKey | BRLCKFCMSQYRNU-UHFFFAOYSA-N |
| Density | 1.149g/cm3 (Cal.) |
|---|---|
| Boiling point | 344.253°C at 760 mmHg (Cal.) |
| Flash point | 176.197°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Hydroxy-3-Methyl-2-Phenylpentanoic Acid |