|
CAS#: 14803-30-6 Product: 2-Methyl-1-(2,2,3-Trimethylcyclopropylidene)-1-Propene No suppilers available for the product. |
| Name | 2-Methyl-1-(2,2,3-Trimethylcyclopropylidene)-1-Propene |
|---|---|
| Synonyms | Cyclopropane, Trimethyl(2-Methyl-1-Propenylidene)-; Propene, 2-Methyl-1-(Trimethylcyclopropylidene)- |
| Molecular Structure | ![]() |
| Molecular Formula | C10H16 |
| Molecular Weight | 136.24 |
| CAS Registry Number | 14803-30-6 |
| SMILES | CC1([C](C1C)=[C]=[C](C)C)C |
| InChI | 1S/C10H16/c1-7(2)6-9-8(3)10(9,4)5/h8H,1-5H3 |
| InChIKey | CRZLECOBVHRLLB-UHFFFAOYSA-N |
| Density | 0.807g/cm3 (Cal.) |
|---|---|
| Boiling point | 160.947°C at 760 mmHg (Cal.) |
| Flash point | 38.19°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methyl-1-(2,2,3-Trimethylcyclopropylidene)-1-Propene |